C13H17F2NO3 — CID 82727091
N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-methyloxolan-3-amine (PubChem CID 82727091) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-methyloxolan-3-amine.
| Compound Name | N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-methyloxolan-3-amine |
|---|---|
| PubChem CID | 82727091 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-[3-(difluoromethoxy)-4-methoxyphenyl]-2-methyloxolan-3-amine |
| SMILES | COc1ccc(NC2CCOC2C)cc1OC(F)F |
| InChI | InChI=1S/C13H17F2NO3/c1-8-10(5-6-18-8)16-9-3-4-11(17-2)12(7-9)19-13(14)15/h3-4,7-8,10,13,16H,5-6H2,1-2H3 |
| InChIKey | KKWIWSBBXYEDOU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|