C14H20N2O4 — CID 132916970
3,4-dimethoxy-N-[(1S,2S)-2-nitrocyclohexyl]aniline (PubChem CID 132916970) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(1S,2S)-2-nitrocyclohexyl]aniline.
| Compound Name | 3,4-dimethoxy-N-[(1S,2S)-2-nitrocyclohexyl]aniline |
|---|---|
| PubChem CID | 132916970 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 3,4-dimethoxy-N-[(1S,2S)-2-nitrocyclohexyl]aniline |
| SMILES | COc1ccc(N[C@H]2CCCC[C@@H]2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C14H20N2O4/c1-19-13-8-7-10(9-14(13)20-2)15-11-5-3-4-6-12(11)16(17)18/h7-9,11-12,15H,3-6H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | HMHGZUAJHDZQLX-RYUDHWBXSA-N |
| XLogP | 2.70 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|