C20H27ClN2O2 — CID 69344166
N-(3,4-dimethoxyphenyl)-3-(4-methylphenyl)piperidin-4-amine;hydrochloride (PubChem CID 69344166) has the molecular formula C20H27ClN2O2 and a molecular weight of 362.90 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-3-(4-methylphenyl)piperidin-4-amine;hydrochloride.
| Compound Name | N-(3,4-dimethoxyphenyl)-3-(4-methylphenyl)piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 69344166 |
| Molecular Formula | C20H27ClN2O2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-3-(4-methylphenyl)piperidin-4-amine;hydrochloride |
| SMILES | COc1ccc(NC2CCNCC2c2ccc(C)cc2)cc1OC.Cl |
| InChI | InChI=1S/C20H26N2O2.ClH/c1-14-4-6-15(7-5-14)17-13-21-11-10-18(17)22-16-8-9-19(23-2)20(12-16)24-3;/h4-9,12,17-18,21-22H,10-11,13H2,1-3H3;1H |
| InChIKey | MYTDCWAPVKBPFE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|