C25H38ClN3O — CID 143706089
N-(3-aminophenyl)-N-propylacetamide;chlorobenzene;(4-methylcyclohexyl)methanamine (PubChem CID 143706089) has the molecular formula C25H38ClN3O and a molecular weight of 432.05 g/mol. Its IUPAC name is N-(3-aminophenyl)-N-propylacetamide;chlorobenzene;(4-methylcyclohexyl)methanamine.
| Compound Name | N-(3-aminophenyl)-N-propylacetamide;chlorobenzene;(4-methylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 143706089 |
| Molecular Formula | C25H38ClN3O |
| Molecular Weight | 432.05 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | N-(3-aminophenyl)-N-propylacetamide;chlorobenzene;(4-methylcyclohexyl)methanamine |
| SMILES | CC1CCC(CN)CC1.CCCN(C(C)=O)c1cccc(N)c1.Clc1ccccc1 |
| InChI | InChI=1S/C11H16N2O.C8H17N.C6H5Cl/c1-3-7-13(9(2)14)11-6-4-5-10(12)8-11;1-7-2-4-8(6-9)5-3-7;7-6-4-2-1-3-5-6/h4-6,8H,3,7,12H2,1-2H3;7-8H,2-6,9H2,1H3;1-5H |
| InChIKey | WEGDLTMJJIAGMA-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.05 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|