C10H21N — CID 143707442
N-(2,4-dimethylpent-4-enyl)methanimine;ethane (PubChem CID 143707442) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is N-(2,4-dimethylpent-4-enyl)methanimine;ethane.
| Compound Name | N-(2,4-dimethylpent-4-enyl)methanimine;ethane |
|---|---|
| PubChem CID | 143707442 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | N-(2,4-dimethylpent-4-enyl)methanimine;ethane |
| SMILES | C=NCC(C)CC(=C)C.CC |
| InChI | InChI=1S/C8H15N.C2H6/c1-7(2)5-8(3)6-9-4;1-2/h8H,1,4-6H2,2-3H3;1-2H3 |
| InChIKey | OZWQNLQJKXEYSM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|