C10H17N — CID 163493586
N-(2-methylocta-5,6-dienyl)methanimine (PubChem CID 163493586) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is N-(2-methylocta-5,6-dienyl)methanimine.
| Compound Name | N-(2-methylocta-5,6-dienyl)methanimine |
|---|---|
| PubChem CID | 163493586 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-(2-methylocta-5,6-dienyl)methanimine |
| SMILES | C=NCC(C)CCC=C=CC |
| InChI | InChI=1S/C10H17N/c1-4-5-6-7-8-10(2)9-11-3/h4,6,10H,3,7-9H2,1-2H3 |
| InChIKey | COSSMBPAZULKBT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|