C21H24BrN3O2 — CID 143711112
benzyl (2S)-2-(5-bromoimidazo[1,2-a]pyridin-2-yl)pyrrolidine-1-carboxylate;ethane (PubChem CID 143711112) has the molecular formula C21H24BrN3O2 and a molecular weight of 430.35 g/mol. Its IUPAC name is benzyl (2S)-2-(5-bromoimidazo[1,2-a]pyridin-2-yl)pyrrolidine-1-carboxylate;ethane.
| Compound Name | benzyl (2S)-2-(5-bromoimidazo[1,2-a]pyridin-2-yl)pyrrolidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143711112 |
| Molecular Formula | C21H24BrN3O2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | benzyl (2S)-2-(5-bromoimidazo[1,2-a]pyridin-2-yl)pyrrolidine-1-carboxylate;ethane |
| SMILES | CC.O=C(OCc1ccccc1)N1CCC[C@H]1c1cn2c(Br)cccc2n1 |
| InChI | InChI=1S/C19H18BrN3O2.C2H6/c20-17-9-4-10-18-21-15(12-23(17)18)16-8-5-11-22(16)19(24)25-13-14-6-2-1-3-7-14;1-2/h1-4,6-7,9-10,12,16H,5,8,11,13H2;1-2H3/t16-;/m0./s1 |
| InChIKey | QMIQQXINRYHGTB-NTISSMGPSA-N |
| XLogP | 5.60 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|