C9H10IN2PS — CID 143712701
[methyl-(3-methylpyrrolo[2,3-b]pyridin-1-yl)phosphanyl] thiohypoiodite (PubChem CID 143712701) has the molecular formula C9H10IN2PS and a molecular weight of 336.14 g/mol. Its IUPAC name is [methyl-(3-methylpyrrolo[2,3-b]pyridin-1-yl)phosphanyl] thiohypoiodite.
| Compound Name | [methyl-(3-methylpyrrolo[2,3-b]pyridin-1-yl)phosphanyl] thiohypoiodite |
|---|---|
| PubChem CID | 143712701 |
| Molecular Formula | C9H10IN2PS |
| Molecular Weight | 336.14 g/mol |
| Exact Mass | 335.93 |
| IUPAC Name | [methyl-(3-methylpyrrolo[2,3-b]pyridin-1-yl)phosphanyl] thiohypoiodite |
| SMILES | Cc1cn(P(C)SI)c2ncccc12 |
| InChI | InChI=1S/C9H10IN2PS/c1-7-6-12(13(2)14-10)9-8(7)4-3-5-11-9/h3-6H,1-2H3 |
| InChIKey | MKBYCALDXOFBLZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.14 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|