C14H20ClFO4 — CID 143713103
3-chloro-6-fluoro-5-[2-(2-methoxyethoxy)ethoxy]cyclohepta-1,4,6-triene-1-carbaldehyde;methane (PubChem CID 143713103) has the molecular formula C14H20ClFO4 and a molecular weight of 306.76 g/mol. Its IUPAC name is 3-chloro-6-fluoro-5-[2-(2-methoxyethoxy)ethoxy]cyclohepta-1,4,6-triene-1-carbaldehyde;methane.
| Compound Name | 3-chloro-6-fluoro-5-[2-(2-methoxyethoxy)ethoxy]cyclohepta-1,4,6-triene-1-carbaldehyde;methane |
|---|---|
| PubChem CID | 143713103 |
| Molecular Formula | C14H20ClFO4 |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 3-chloro-6-fluoro-5-[2-(2-methoxyethoxy)ethoxy]cyclohepta-1,4,6-triene-1-carbaldehyde;methane |
| SMILES | C.COCCOCCOC1=CC(Cl)C=C(C=O)C=C1F |
| InChI | InChI=1S/C13H16ClFO4.CH4/c1-17-2-3-18-4-5-19-13-8-11(14)6-10(9-16)7-12(13)15;/h6-9,11H,2-5H2,1H3;1H4 |
| InChIKey | AMHSANPVYDLHRX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|