C14H19FO5 — CID 143712951
2-fluoro-5-methoxy-4-[2-(2-methoxyethoxy)ethoxy]cyclohepta-1,3,5-triene-1-carbaldehyde (PubChem CID 143712951) has the molecular formula C14H19FO5 and a molecular weight of 286.30 g/mol. Its IUPAC name is 2-fluoro-5-methoxy-4-[2-(2-methoxyethoxy)ethoxy]cyclohepta-1,3,5-triene-1-carbaldehyde.
| Compound Name | 2-fluoro-5-methoxy-4-[2-(2-methoxyethoxy)ethoxy]cyclohepta-1,3,5-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 143712951 |
| Molecular Formula | C14H19FO5 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-fluoro-5-methoxy-4-[2-(2-methoxyethoxy)ethoxy]cyclohepta-1,3,5-triene-1-carbaldehyde |
| SMILES | COCCOCCOC1=CC(F)=C(C=O)CC=C1OC |
| InChI | InChI=1S/C14H19FO5/c1-17-5-6-19-7-8-20-14-9-12(15)11(10-16)3-4-13(14)18-2/h4,9-10H,3,5-8H2,1-2H3 |
| InChIKey | UTGSDYLGRAPNHP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|