C12H20O4 — CID 142184691
(Z)-3-[(E)-2,3-dimethoxyprop-1-enyl]-5-methoxyhex-3-enal (PubChem CID 142184691) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (Z)-3-[(E)-2,3-dimethoxyprop-1-enyl]-5-methoxyhex-3-enal.
| Compound Name | (Z)-3-[(E)-2,3-dimethoxyprop-1-enyl]-5-methoxyhex-3-enal |
|---|---|
| PubChem CID | 142184691 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (Z)-3-[(E)-2,3-dimethoxyprop-1-enyl]-5-methoxyhex-3-enal |
| SMILES | COC/C(=C\C(=C/C(C)OC)CC=O)OC |
| InChI | InChI=1S/C12H20O4/c1-10(15-3)7-11(5-6-13)8-12(16-4)9-14-2/h6-8,10H,5,9H2,1-4H3/b11-7-,12-8+ |
| InChIKey | ITOYVCWUJPIMEG-NTLHZVPKSA-N |
| XLogP | 1.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|