C11H14O4 — CID 143198208
3,4,5-trimethoxycyclohepta-1,3,5-triene-1-carbaldehyde (PubChem CID 143198208) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3,4,5-trimethoxycyclohepta-1,3,5-triene-1-carbaldehyde.
| Compound Name | 3,4,5-trimethoxycyclohepta-1,3,5-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 143198208 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 3,4,5-trimethoxycyclohepta-1,3,5-triene-1-carbaldehyde |
| SMILES | COC1=CCC(C=O)=CC(OC)=C1OC |
| InChI | InChI=1S/C11H14O4/c1-13-9-5-4-8(7-12)6-10(14-2)11(9)15-3/h5-7H,4H2,1-3H3 |
| InChIKey | OVTWFTULRDRMSW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|