C9H10O3 — CID 89030630
3,4-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-one (PubChem CID 89030630) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 3,4-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-one.
| Compound Name | 3,4-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 89030630 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 3,4-dimethoxy-6-methylidenecyclohexa-2,4-dien-1-one |
| SMILES | C=C1C=C(OC)C(OC)=CC1=O |
| InChI | InChI=1S/C9H10O3/c1-6-4-8(11-2)9(12-3)5-7(6)10/h4-5H,1H2,2-3H3 |
| InChIKey | BLZBSWPVVNXSEB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|