C13H18O4 — CID 143294869
4-methoxy-3-(3-methoxypropoxy)cyclohepta-1,3,5-triene-1-carbaldehyde (PubChem CID 143294869) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-methoxy-3-(3-methoxypropoxy)cyclohepta-1,3,5-triene-1-carbaldehyde.
| Compound Name | 4-methoxy-3-(3-methoxypropoxy)cyclohepta-1,3,5-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 143294869 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-methoxy-3-(3-methoxypropoxy)cyclohepta-1,3,5-triene-1-carbaldehyde |
| SMILES | COCCCOC1=C(OC)C=CCC(C=O)=C1 |
| InChI | InChI=1S/C13H18O4/c1-15-7-4-8-17-13-9-11(10-14)5-3-6-12(13)16-2/h3,6,9-10H,4-5,7-8H2,1-2H3 |
| InChIKey | IGHCDVGEBKLVQS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|