C19H20ClFN2O4 — CID 143713120
(E,2E)-1-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-fluoro-2-[1-methoxy-2-(2-methoxyethoxy)ethylidene]hex-3-en-5-yn-1-ol (PubChem CID 143713120) has the molecular formula C19H20ClFN2O4 and a molecular weight of 394.83 g/mol. Its IUPAC name is (E,2E)-1-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-fluoro-2-[1-methoxy-2-(2-methoxyethoxy)ethylidene]hex-3-en-5-yn-1-ol.
| Compound Name | (E,2E)-1-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-fluoro-2-[1-methoxy-2-(2-methoxyethoxy)ethylidene]hex-3-en-5-yn-1-ol |
|---|---|
| PubChem CID | 143713120 |
| Molecular Formula | C19H20ClFN2O4 |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (E,2E)-1-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-3-fluoro-2-[1-methoxy-2-(2-methoxyethoxy)ethylidene]hex-3-en-5-yn-1-ol |
| SMILES | C#C/C=C(F)\C(=C(/COCCOC)OC)C(O)c1c[nH]c2ncc(Cl)cc12 |
| InChI | InChI=1S/C19H20ClFN2O4/c1-4-5-15(21)17(16(26-3)11-27-7-6-25-2)18(24)14-10-23-19-13(14)8-12(20)9-22-19/h1,5,8-10,18,24H,6-7,11H2,2-3H3,(H,22,23)/b15-5+,17-16- |
| InChIKey | ZKKDRALMVKZACZ-CRYTZHILSA-N |
| XLogP | 3.30 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|