C19H25N5O3 — CID 143713573
2-amino-2-[[4-(pyridin-4-ylcarbamoylamino)phenyl]methylamino]hexanoic acid (PubChem CID 143713573) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-amino-2-[[4-(pyridin-4-ylcarbamoylamino)phenyl]methylamino]hexanoic acid.
| Compound Name | 2-amino-2-[[4-(pyridin-4-ylcarbamoylamino)phenyl]methylamino]hexanoic acid |
|---|---|
| PubChem CID | 143713573 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 2-amino-2-[[4-(pyridin-4-ylcarbamoylamino)phenyl]methylamino]hexanoic acid |
| SMILES | CCCCC(N)(NCc1ccc(NC(=O)Nc2ccncc2)cc1)C(=O)O |
| InChI | InChI=1S/C19H25N5O3/c1-2-3-10-19(20,17(25)26)22-13-14-4-6-15(7-5-14)23-18(27)24-16-8-11-21-12-9-16/h4-9,11-12,22H,2-3,10,13,20H2,1H3,(H,25,26)(H2,21,23,24,27) |
| InChIKey | BLDCHNUHJVRPRN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|