C12H21N3O — CID 143714165
3-ethyl-5-(4-propylpiperidin-1-yl)-1,2,4-oxadiazole (PubChem CID 143714165) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-ethyl-5-(4-propylpiperidin-1-yl)-1,2,4-oxadiazole.
| Compound Name | 3-ethyl-5-(4-propylpiperidin-1-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 143714165 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 3-ethyl-5-(4-propylpiperidin-1-yl)-1,2,4-oxadiazole |
| SMILES | CCCC1CCN(c2nc(CC)no2)CC1 |
| InChI | InChI=1S/C12H21N3O/c1-3-5-10-6-8-15(9-7-10)12-13-11(4-2)14-16-12/h10H,3-9H2,1-2H3 |
| InChIKey | ZFPDBALIALNOJR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |