C21H31N3O4S — CID 24963865
5-[4-[3-(3-methyl-4-methylsulfonylphenoxy)propyl]piperidin-1-yl]-3-propyl-1,2,4-oxadiazole (PubChem CID 24963865) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is 5-[4-[3-(3-methyl-4-methylsulfonylphenoxy)propyl]piperidin-1-yl]-3-propyl-1,2,4-oxadiazole.
| Compound Name | 5-[4-[3-(3-methyl-4-methylsulfonylphenoxy)propyl]piperidin-1-yl]-3-propyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 24963865 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 5-[4-[3-(3-methyl-4-methylsulfonylphenoxy)propyl]piperidin-1-yl]-3-propyl-1,2,4-oxadiazole |
| SMILES | CCCc1noc(N2CCC(CCCOc3ccc(S(C)(=O)=O)c(C)c3)CC2)n1 |
| InChI | InChI=1S/C21H31N3O4S/c1-4-6-20-22-21(28-23-20)24-12-10-17(11-13-24)7-5-14-27-18-8-9-19(16(2)15-18)29(3,25)26/h8-9,15,17H,4-7,10-14H2,1-3H3 |
| InChIKey | XXYKDYFLCGNWMI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|