C21H28N4O4 — CID 88854142
2-methyl-N-oxo-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzamide (PubChem CID 88854142) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-methyl-N-oxo-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzamide.
| Compound Name | 2-methyl-N-oxo-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzamide |
|---|---|
| PubChem CID | 88854142 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-methyl-N-oxo-4-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]benzamide |
| SMILES | Cc1cc(OCCCC2CCN(c3nc(C(C)C)no3)CC2)ccc1C(=O)N=O |
| InChI | InChI=1S/C21H28N4O4/c1-14(2)19-22-21(29-24-19)25-10-8-16(9-11-25)5-4-12-28-17-6-7-18(15(3)13-17)20(26)23-27/h6-7,13-14,16H,4-5,8-12H2,1-3H3 |
| InChIKey | WMYKTFOYEPOHBE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 97.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|