C22H32N4O3 — CID 24986467
2-methyl-4-[3-[1-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]piperidin-4-yl]propoxy]benzamide (PubChem CID 24986467) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-methyl-4-[3-[1-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]piperidin-4-yl]propoxy]benzamide.
| Compound Name | 2-methyl-4-[3-[1-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]piperidin-4-yl]propoxy]benzamide |
|---|---|
| PubChem CID | 24986467 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 2-methyl-4-[3-[1-[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]piperidin-4-yl]propoxy]benzamide |
| SMILES | Cc1cc(OCCCC2CCN(c3nc(CC(C)C)no3)CC2)ccc1C(N)=O |
| InChI | InChI=1S/C22H32N4O3/c1-15(2)13-20-24-22(29-25-20)26-10-8-17(9-11-26)5-4-12-28-18-6-7-19(21(23)27)16(3)14-18/h6-7,14-15,17H,4-5,8-13H2,1-3H3,(H2,23,27) |
| InChIKey | CEUMDONLYQNLQD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|