C22H30FN3O4 — CID 67454824
methyl 4-[3-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]-2-fluorobenzoate (PubChem CID 67454824) has the molecular formula C22H30FN3O4 and a molecular weight of 419.50 g/mol. Its IUPAC name is methyl 4-[3-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]-2-fluorobenzoate.
| Compound Name | methyl 4-[3-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]-2-fluorobenzoate |
|---|---|
| PubChem CID | 67454824 |
| Molecular Formula | C22H30FN3O4 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | methyl 4-[3-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(OCCCC2CCN(c3nc(C(C)(C)C)no3)CC2)cc1F |
| InChI | InChI=1S/C22H30FN3O4/c1-22(2,3)20-24-21(30-25-20)26-11-9-15(10-12-26)6-5-13-29-16-7-8-17(18(23)14-16)19(27)28-4/h7-8,14-15H,5-6,9-13H2,1-4H3 |
| InChIKey | BGBJKFMSKAHNTJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|