C12H17Cl5N2O2S — CID 143714220
N-[3-amino-4-(pentachloro-λ6-sulfanyl)phenyl]-2-propoxypropanamide (PubChem CID 143714220) has the molecular formula C12H17Cl5N2O2S and a molecular weight of 430.61 g/mol. Its IUPAC name is N-[3-amino-4-(pentachloro-λ6-sulfanyl)phenyl]-2-propoxypropanamide.
| Compound Name | N-[3-amino-4-(pentachloro-λ6-sulfanyl)phenyl]-2-propoxypropanamide |
|---|---|
| PubChem CID | 143714220 |
| Molecular Formula | C12H17Cl5N2O2S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 427.95 |
| IUPAC Name | N-[3-amino-4-(pentachloro-λ6-sulfanyl)phenyl]-2-propoxypropanamide |
| SMILES | CCCOC(C)C(=O)Nc1ccc(S(Cl)(Cl)(Cl)(Cl)Cl)c(N)c1 |
| InChI | InChI=1S/C12H17Cl5N2O2S/c1-3-6-21-8(2)12(20)19-9-4-5-11(10(18)7-9)22(13,14,15,16)17/h4-5,7-8H,3,6,18H2,1-2H3,(H,19,20) |
| InChIKey | DQYDIRJESHXECL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|