C8H9FN2O3 — CID 143716131
5-fluoro-6-methylpyridine-2-carboxylic acid;formamide (PubChem CID 143716131) has the molecular formula C8H9FN2O3 and a molecular weight of 200.17 g/mol. Its IUPAC name is 5-fluoro-6-methylpyridine-2-carboxylic acid;formamide.
| Compound Name | 5-fluoro-6-methylpyridine-2-carboxylic acid;formamide |
|---|---|
| PubChem CID | 143716131 |
| Molecular Formula | C8H9FN2O3 |
| Molecular Weight | 200.17 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 5-fluoro-6-methylpyridine-2-carboxylic acid;formamide |
| SMILES | Cc1nc(C(=O)O)ccc1F.NC=O |
| InChI | InChI=1S/C7H6FNO2.CH3NO/c1-4-5(8)2-3-6(9-4)7(10)11;2-1-3/h2-3H,1H3,(H,10,11);1H,(H2,2,3) |
| InChIKey | ISWLCMKODWMAML-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.17 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|