C30H44O2 — CID 143717290
(3S,10R,13S)-10-ethyl-17-[(2S)-2-hydroxy-1-(3-methylphenyl)propan-2-yl]-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 143717290) has the molecular formula C30H44O2 and a molecular weight of 436.68 g/mol. Its IUPAC name is (3S,10R,13S)-10-ethyl-17-[(2S)-2-hydroxy-1-(3-methylphenyl)propan-2-yl]-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10R,13S)-10-ethyl-17-[(2S)-2-hydroxy-1-(3-methylphenyl)propan-2-yl]-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 143717290 |
| Molecular Formula | C30H44O2 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | (3S,10R,13S)-10-ethyl-17-[(2S)-2-hydroxy-1-(3-methylphenyl)propan-2-yl]-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@]12CC[C@H](O)CC1=CCC1C2CC[C@@]2(C)C1CCC2[C@@](C)(O)Cc1cccc(C)c1 |
| InChI | InChI=1S/C30H44O2/c1-5-30-16-13-23(31)18-22(30)9-10-24-25-11-12-27(28(25,3)15-14-26(24)30)29(4,32)19-21-8-6-7-20(2)17-21/h6-9,17,23-27,31-32H,5,10-16,18-19H2,1-4H3/t23-,24?,25?,26?,27?,28-,29-,30-/m0/s1 |
| InChIKey | IHMDZNFCALJWNZ-ZWFNOTAXSA-N |
| XLogP | 6.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|