C22H34N2O4 — CID 143718647
ethyl 3,6-dimethoxy-5-(4-phenylbutyl)-2H-pyrazine-5-carboxylate;propane (PubChem CID 143718647) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is ethyl 3,6-dimethoxy-5-(4-phenylbutyl)-2H-pyrazine-5-carboxylate;propane.
| Compound Name | ethyl 3,6-dimethoxy-5-(4-phenylbutyl)-2H-pyrazine-5-carboxylate;propane |
|---|---|
| PubChem CID | 143718647 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | ethyl 3,6-dimethoxy-5-(4-phenylbutyl)-2H-pyrazine-5-carboxylate;propane |
| SMILES | CCC.CCOC(=O)C1(CCCCc2ccccc2)N=C(OC)CN=C1OC |
| InChI | InChI=1S/C19H26N2O4.C3H8/c1-4-25-18(22)19(17(24-3)20-14-16(21-19)23-2)13-9-8-12-15-10-6-5-7-11-15;1-3-2/h5-7,10-11H,4,8-9,12-14H2,1-3H3;3H2,1-2H3 |
| InChIKey | CPDXAHWTRGNWIQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|