C25H29N4O4+ — CID 143719833
[(Z)-3-amino-3-[(2R)-2-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-2-phenylacetyl]iminoprop-1-enyl]oxidanium (PubChem CID 143719833) has the molecular formula C25H29N4O4+ and a molecular weight of 449.53 g/mol. Its IUPAC name is [(Z)-3-amino-3-[(2R)-2-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-2-phenylacetyl]iminoprop-1-enyl]oxidanium.
| Compound Name | [(Z)-3-amino-3-[(2R)-2-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-2-phenylacetyl]iminoprop-1-enyl]oxidanium |
|---|---|
| PubChem CID | 143719833 |
| Molecular Formula | C25H29N4O4+ |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | [(Z)-3-amino-3-[(2R)-2-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-2-phenylacetyl]iminoprop-1-enyl]oxidanium |
| SMILES | NC(/C=C\[OH2+])=N\C(=O)[C@H](NCC(=O)N1CCC2(CC1)OCc1ccccc12)c1ccccc1 |
| InChI | InChI=1S/C25H28N4O4/c26-21(10-15-30)28-24(32)23(18-6-2-1-3-7-18)27-16-22(31)29-13-11-25(12-14-29)20-9-5-4-8-19(20)17-33-25/h1-10,15,23,27,30H,11-14,16-17H2,(H2,26,28,32)/p+1/b15-10-/t23-/m1/s1 |
| InChIKey | WJJWHRQDAUDPQL-IJFZUYQYSA-O |
| XLogP | 1.49 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|