C28H38N2O3 — CID 143719845
4-(4-ethylphenyl)-4-[(2-oxo-2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylethyl)amino]butanal;methanol (PubChem CID 143719845) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-4-[(2-oxo-2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylethyl)amino]butanal;methanol.
| Compound Name | 4-(4-ethylphenyl)-4-[(2-oxo-2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylethyl)amino]butanal;methanol |
|---|---|
| PubChem CID | 143719845 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 4-(4-ethylphenyl)-4-[(2-oxo-2-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylethyl)amino]butanal;methanol |
| SMILES | CCc1ccc(C(CCC=O)NCC(=O)N2CCC3(CCc4ccccc43)CC2)cc1.CO |
| InChI | InChI=1S/C27H34N2O2.CH4O/c1-2-21-9-11-23(12-10-21)25(8-5-19-30)28-20-26(31)29-17-15-27(16-18-29)14-13-22-6-3-4-7-24(22)27;1-2/h3-4,6-7,9-12,19,25,28H,2,5,8,13-18,20H2,1H3;2H,1H3 |
| InChIKey | YUSHNKVJQYMOJX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|