C31H41F3N2 — CID 143721867
2-(3,3-difluorobutan-2-yl)-2,7-dihydro-1H-azepine;ethene;N-[(1E,3Z,5Z)-1-(4-fluorophenyl)-2-methylhepta-1,3,5-trienyl]-3-methylbut-3-en-2-imine (PubChem CID 143721867) has the molecular formula C31H41F3N2 and a molecular weight of 498.68 g/mol. Its IUPAC name is 2-(3,3-difluorobutan-2-yl)-2,7-dihydro-1H-azepine;ethene;N-[(1E,3Z,5Z)-1-(4-fluorophenyl)-2-methylhepta-1,3,5-trienyl]-3-methylbut-3-en-2-imine.
| Compound Name | 2-(3,3-difluorobutan-2-yl)-2,7-dihydro-1H-azepine;ethene;N-[(1E,3Z,5Z)-1-(4-fluorophenyl)-2-methylhepta-1,3,5-trienyl]-3-methylbut-3-en-2-imine |
|---|---|
| PubChem CID | 143721867 |
| Molecular Formula | C31H41F3N2 |
| Molecular Weight | 498.68 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | 2-(3,3-difluorobutan-2-yl)-2,7-dihydro-1H-azepine;ethene;N-[(1E,3Z,5Z)-1-(4-fluorophenyl)-2-methylhepta-1,3,5-trienyl]-3-methylbut-3-en-2-imine |
| SMILES | C=C.C=C(C)/C(C)=N/C(=C(C)/C=C\C=C/C)c1ccc(F)cc1.CC(C1C=CC=CCN1)C(C)(F)F |
| InChI | InChI=1S/C19H22FN.C10H15F2N.C2H4/c1-6-7-8-9-15(4)19(21-16(5)14(2)3)17-10-12-18(20)13-11-17;1-8(10(2,11)12)9-6-4-3-5-7-13-9;1-2/h6-13H,2H2,1,3-5H3;3-6,8-9,13H,7H2,1-2H3;1-2H2/b7-6-,9-8-,19-15+,21-16+;; |
| InChIKey | WXWQELFXPJPXPI-NKMLHMBASA-N |
| XLogP | 8.89 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.68 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|