C31H40F2N4 — CID 57061319
2-[[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-methyl-6-propan-2-ylcyclohepta-3,5-dien-1-ylidene]amino]-N-methylethanamine (PubChem CID 57061319) has the molecular formula C31H40F2N4 and a molecular weight of 506.69 g/mol. Its IUPAC name is 2-[[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-methyl-6-propan-2-ylcyclohepta-3,5-dien-1-ylidene]amino]-N-methylethanamine.
| Compound Name | 2-[[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-methyl-6-propan-2-ylcyclohepta-3,5-dien-1-ylidene]amino]-N-methylethanamine |
|---|---|
| PubChem CID | 57061319 |
| Molecular Formula | C31H40F2N4 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | 2-[[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-2-methyl-6-propan-2-ylcyclohepta-3,5-dien-1-ylidene]amino]-N-methylethanamine |
| SMILES | CNCC/N=C1\CC(C(C)C)=CC=C(N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)C1C |
| InChI | InChI=1S/C31H40F2N4/c1-22(2)26-9-14-30(23(3)29(21-26)35-16-15-34-4)36-17-19-37(20-18-36)31(24-5-10-27(32)11-6-24)25-7-12-28(33)13-8-25/h5-14,22-23,31,34H,15-21H2,1-4H3/b35-29+ |
| InChIKey | ULGNZYGDJLMXBR-OZMGXUMRSA-N |
| XLogP | 5.84 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|