C20H22F2N2O — CID 57396354
(2R,3S,5R,6S)-2,6-bis(3-fluorophenyl)-N-methoxy-3,5-dimethylpiperidin-4-imine (PubChem CID 57396354) has the molecular formula C20H22F2N2O and a molecular weight of 344.41 g/mol. Its IUPAC name is (2R,3S,5R,6S)-2,6-bis(3-fluorophenyl)-N-methoxy-3,5-dimethylpiperidin-4-imine.
| Compound Name | (2R,3S,5R,6S)-2,6-bis(3-fluorophenyl)-N-methoxy-3,5-dimethylpiperidin-4-imine |
|---|---|
| PubChem CID | 57396354 |
| Molecular Formula | C20H22F2N2O |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (2R,3S,5R,6S)-2,6-bis(3-fluorophenyl)-N-methoxy-3,5-dimethylpiperidin-4-imine |
| SMILES | CO/N=C1/[C@@H](C)[C@H](c2cccc(F)c2)N[C@H](c2cccc(F)c2)[C@H]1C |
| InChI | InChI=1S/C20H22F2N2O/c1-12-18(24-25-3)13(2)20(15-7-5-9-17(22)11-15)23-19(12)14-6-4-8-16(21)10-14/h4-13,19-20,23H,1-3H3/b24-18-/t12-,13+,19-,20+/m1/s1 |
| InChIKey | SRTYIJAODZICQH-NTCPBZNLSA-N |
| XLogP | 4.62 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|