C12H15FO — CID 114873260
3-(3-fluorophenyl)-2,4-dimethylcyclobutan-1-ol (PubChem CID 114873260) has the molecular formula C12H15FO and a molecular weight of 194.25 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2,4-dimethylcyclobutan-1-ol.
| Compound Name | 3-(3-fluorophenyl)-2,4-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 114873260 |
| Molecular Formula | C12H15FO |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-(3-fluorophenyl)-2,4-dimethylcyclobutan-1-ol |
| SMILES | CC1C(O)C(C)C1c1cccc(F)c1 |
| InChI | InChI=1S/C12H15FO/c1-7-11(8(2)12(7)14)9-4-3-5-10(13)6-9/h3-8,11-12,14H,1-2H3 |
| InChIKey | NFWYQUZGWFATPL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |