C23H21N3O6 — CID 143723023
N-formyl-2-methyl-N-[3-[2-nitro-5-(2-oxo-1-pyridinyl)phenoxy]propyl]benzamide (PubChem CID 143723023) has the molecular formula C23H21N3O6 and a molecular weight of 435.44 g/mol. Its IUPAC name is N-formyl-2-methyl-N-[3-[2-nitro-5-(2-oxo-1-pyridinyl)phenoxy]propyl]benzamide.
| Compound Name | N-formyl-2-methyl-N-[3-[2-nitro-5-(2-oxo-1-pyridinyl)phenoxy]propyl]benzamide |
|---|---|
| PubChem CID | 143723023 |
| Molecular Formula | C23H21N3O6 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-formyl-2-methyl-N-[3-[2-nitro-5-(2-oxo-1-pyridinyl)phenoxy]propyl]benzamide |
| SMILES | Cc1ccccc1C(=O)N(C=O)CCCOc1cc(-n2ccccc2=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H21N3O6/c1-17-7-2-3-8-19(17)23(29)24(16-27)12-6-14-32-21-15-18(10-11-20(21)26(30)31)25-13-5-4-9-22(25)28/h2-5,7-11,13,15-16H,6,12,14H2,1H3 |
| InChIKey | VQTULRSTIXTERX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 111.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|