About 2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate
2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate (PubChem CID 71988169) has the molecular formula C15H14N2O5
and a molecular weight of 302.29 g/mol. Its IUPAC name is 2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate.
Molecular Properties
| Compound Name | 2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate |
| PubChem CID | 71988169 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate |
| SMILES | Cc1ccc([N+](=O)[O-])c(C(=O)OCCn2ccccc2=O)c1 |
| InChI | InChI=1S/C15H14N2O5/c1-11-5-6-13(17(20)21)12(10-11)15(19)22-9-8-16-7-3-2-4-14(16)18/h2-7,10H,8-9H2,1H3 |
| InChIKey | BQKGFJSWWCPKKW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate?
The IUPAC name of 2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate (CID 71988169) is 2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate.
What is the SMILES notation for 2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate?
The canonical SMILES for 2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate is Cc1ccc([N+](=O)[O-])c(C(=O)OCCn2ccccc2=O)c1.
What is the InChIKey of 2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate?
The InChIKey is BQKGFJSWWCPKKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O5/c1-11-5-6-13(17(20)21)12(10-11)15(19)22-9-8-16-7-3-2-4-14(16)18/h2-7,10H,8-9H2,1H3.
What are the key properties of 2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate?
2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate has a molecular weight of 302.29 g/mol, XLogP of 1.92, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-1-pyridinyl)ethyl 5-methyl-2-nitrobenzoate is sourced from PubChem (CID 71988169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).