C22H24F3N3O2S — CID 143723966
3-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-[(4-methylphenyl)methyl]-1,3-thiazolidine-2-carboxamide (PubChem CID 143723966) has the molecular formula C22H24F3N3O2S and a molecular weight of 451.51 g/mol. Its IUPAC name is 3-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-[(4-methylphenyl)methyl]-1,3-thiazolidine-2-carboxamide.
| Compound Name | 3-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-[(4-methylphenyl)methyl]-1,3-thiazolidine-2-carboxamide |
|---|---|
| PubChem CID | 143723966 |
| Molecular Formula | C22H24F3N3O2S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 3-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N-[(4-methylphenyl)methyl]-1,3-thiazolidine-2-carboxamide |
| SMILES | Cc1ccc(CNC(=O)C2SCCN2C(=O)CC(N)Cc2cc(F)c(F)cc2F)cc1 |
| InChI | InChI=1S/C22H24F3N3O2S/c1-13-2-4-14(5-3-13)12-27-21(30)22-28(6-7-31-22)20(29)10-16(26)8-15-9-18(24)19(25)11-17(15)23/h2-5,9,11,16,22H,6-8,10,12,26H2,1H3,(H,27,30) |
| InChIKey | PTCSHRCMFSXEEQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|