C26H31F3N2O5S — CID 143724027
1-(2-acetyl-1,3-thiazolidin-3-yl)-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;2-(4-ethylphenoxy)propanoic acid (PubChem CID 143724027) has the molecular formula C26H31F3N2O5S and a molecular weight of 540.60 g/mol. Its IUPAC name is 1-(2-acetyl-1,3-thiazolidin-3-yl)-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;2-(4-ethylphenoxy)propanoic acid.
| Compound Name | 1-(2-acetyl-1,3-thiazolidin-3-yl)-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;2-(4-ethylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 143724027 |
| Molecular Formula | C26H31F3N2O5S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 1-(2-acetyl-1,3-thiazolidin-3-yl)-3-amino-4-(2,4,5-trifluorophenyl)butan-1-one;2-(4-ethylphenoxy)propanoic acid |
| SMILES | CC(=O)C1SCCN1C(=O)CC(N)Cc1cc(F)c(F)cc1F.CCc1ccc(OC(C)C(=O)O)cc1 |
| InChI | InChI=1S/C15H17F3N2O2S.C11H14O3/c1-8(21)15-20(2-3-23-15)14(22)6-10(19)4-9-5-12(17)13(18)7-11(9)16;1-3-9-4-6-10(7-5-9)14-8(2)11(12)13/h5,7,10,15H,2-4,6,19H2,1H3;4-8H,3H2,1-2H3,(H,12,13) |
| InChIKey | HKBHYJSZQCRPKQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|