C16H25NO6 — CID 143725740
ethyl 1-[2-[(2R,3R)-2-hydroxy-3-methyloxan-2-yl]-2-oxoacetyl]piperidine-2-carboxylate (PubChem CID 143725740) has the molecular formula C16H25NO6 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl 1-[2-[(2R,3R)-2-hydroxy-3-methyloxan-2-yl]-2-oxoacetyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[2-[(2R,3R)-2-hydroxy-3-methyloxan-2-yl]-2-oxoacetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 143725740 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | ethyl 1-[2-[(2R,3R)-2-hydroxy-3-methyloxan-2-yl]-2-oxoacetyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)C(=O)[C@]1(O)OCCC[C@H]1C |
| InChI | InChI=1S/C16H25NO6/c1-3-22-15(20)12-8-4-5-9-17(12)14(19)13(18)16(21)11(2)7-6-10-23-16/h11-12,21H,3-10H2,1-2H3/t11-,12?,16-/m1/s1 |
| InChIKey | OTDKQCUPVJVSCD-DLTQXHKRSA-N |
| XLogP | 0.63 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|