C23H39NO7 — CID 143131352
(5-hydroxy-2-methyloctyl) 1-[2-(2-hydroxy-3-methyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate (PubChem CID 143131352) has the molecular formula C23H39NO7 and a molecular weight of 441.57 g/mol. Its IUPAC name is (5-hydroxy-2-methyloctyl) 1-[2-(2-hydroxy-3-methyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate.
| Compound Name | (5-hydroxy-2-methyloctyl) 1-[2-(2-hydroxy-3-methyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 143131352 |
| Molecular Formula | C23H39NO7 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | (5-hydroxy-2-methyloctyl) 1-[2-(2-hydroxy-3-methyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate |
| SMILES | CCCC(O)CCC(C)COC(=O)C1CCCCN1C(=O)C(=O)C1(O)OCCCC1C |
| InChI | InChI=1S/C23H39NO7/c1-4-8-18(25)12-11-16(2)15-30-22(28)19-10-5-6-13-24(19)21(27)20(26)23(29)17(3)9-7-14-31-23/h16-19,25,29H,4-15H2,1-3H3 |
| InChIKey | UFMBNMCPIKCIKH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|