C26H43NO7 — CID 145119133
[(E)-6-hydroxy-3,5-dimethylhept-3-en-2-yl] 1-[2-(2-hydroxy-3-methyl-6-propan-2-yloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate (PubChem CID 145119133) has the molecular formula C26H43NO7 and a molecular weight of 481.63 g/mol. Its IUPAC name is [(E)-6-hydroxy-3,5-dimethylhept-3-en-2-yl] 1-[2-(2-hydroxy-3-methyl-6-propan-2-yloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate.
| Compound Name | [(E)-6-hydroxy-3,5-dimethylhept-3-en-2-yl] 1-[2-(2-hydroxy-3-methyl-6-propan-2-yloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 145119133 |
| Molecular Formula | C26H43NO7 |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | [(E)-6-hydroxy-3,5-dimethylhept-3-en-2-yl] 1-[2-(2-hydroxy-3-methyl-6-propan-2-yloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate |
| SMILES | C/C(=C\C(C)C(C)O)C(C)OC(=O)C1CCCCN1C(=O)C(=O)C1(O)OC(C(C)C)CCC1C |
| InChI | InChI=1S/C26H43NO7/c1-15(2)22-12-11-18(5)26(32,34-22)23(29)24(30)27-13-9-8-10-21(27)25(31)33-20(7)17(4)14-16(3)19(6)28/h14-16,18-22,28,32H,8-13H2,1-7H3/b17-14+ |
| InChIKey | KPDSMZNBPREOAU-SAPNQHFASA-N |
| XLogP | 2.99 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|