C32H55NO8 — CID 121479728
[(2R,3S)-1-[(1S,2S,3S,4R)-2-hydroxy-3-methoxy-4-methylcyclohexyl]-2,4-dimethylpentan-3-yl] (2S)-1-[2-[(2R,3R)-2-hydroxy-3-methyl-6-propan-2-yloxan-2-yl]-2-oxoacetyl]piperidine-2-carboxylate (PubChem CID 121479728) has the molecular formula C32H55NO8 and a molecular weight of 581.79 g/mol. Its IUPAC name is [(2R,3S)-1-[(1S,2S,3S,4R)-2-hydroxy-3-methoxy-4-methylcyclohexyl]-2,4-dimethylpentan-3-yl] (2S)-1-[2-[(2R,3R)-2-hydroxy-3-methyl-6-propan-2-yloxan-2-yl]-2-oxoacetyl]piperidine-2-carboxylate.
| Compound Name | [(2R,3S)-1-[(1S,2S,3S,4R)-2-hydroxy-3-methoxy-4-methylcyclohexyl]-2,4-dimethylpentan-3-yl] (2S)-1-[2-[(2R,3R)-2-hydroxy-3-methyl-6-propan-2-yloxan-2-yl]-2-oxoacetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 121479728 |
| Molecular Formula | C32H55NO8 |
| Molecular Weight | 581.79 g/mol |
| Exact Mass | 581.39 |
| IUPAC Name | [(2R,3S)-1-[(1S,2S,3S,4R)-2-hydroxy-3-methoxy-4-methylcyclohexyl]-2,4-dimethylpentan-3-yl] (2S)-1-[2-[(2R,3R)-2-hydroxy-3-methyl-6-propan-2-yloxan-2-yl]-2-oxoacetyl]piperidine-2-carboxylate |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](C[C@@H](C)[C@@H](OC(=O)[C@@H]2CCCCN2C(=O)C(=O)[C@]2(O)OC(C(C)C)CC[C@H]2C)C(C)C)CC[C@H]1C |
| InChI | InChI=1S/C32H55NO8/c1-18(2)25-15-13-22(7)32(38,41-25)29(35)30(36)33-16-10-9-11-24(33)31(37)40-27(19(3)4)21(6)17-23-14-12-20(5)28(39-8)26(23)34/h18-28,34,38H,9-17H2,1-8H3/t20-,21-,22-,23+,24+,25?,26+,27+,28+,32-/m1/s1 |
| InChIKey | DCRDAWIUKNYMNS-IBWSRXAQSA-N |
| XLogP | 4.11 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.79 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|