C28H47NO8S — CID 145118434
ethane;1-(5-hydroxy-4-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)ethyl 1-[2-(2-hydroxy-3-methyl-6-sulfanyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate (PubChem CID 145118434) has the molecular formula C28H47NO8S and a molecular weight of 557.75 g/mol. Its IUPAC name is ethane;1-(5-hydroxy-4-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)ethyl 1-[2-(2-hydroxy-3-methyl-6-sulfanyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate.
| Compound Name | ethane;1-(5-hydroxy-4-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)ethyl 1-[2-(2-hydroxy-3-methyl-6-sulfanyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 145118434 |
| Molecular Formula | C28H47NO8S |
| Molecular Weight | 557.75 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | ethane;1-(5-hydroxy-4-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)ethyl 1-[2-(2-hydroxy-3-methyl-6-sulfanyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate |
| SMILES | CC.COC1C(O)CCC2CC(C(C)OC(=O)C3CCCCN3C(=O)C(=O)C3(O)OC(S)CCC3C)CC21 |
| InChI | InChI=1S/C26H41NO8S.C2H6/c1-14-7-10-21(36)35-26(14,32)23(29)24(30)27-11-5-4-6-19(27)25(31)34-15(2)17-12-16-8-9-20(28)22(33-3)18(16)13-17;1-2/h14-22,28,32,36H,4-13H2,1-3H3;1-2H3 |
| InChIKey | HWXPNLXKPMZSQF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.75 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|