C26H37NO6S — CID 145118419
3-benzylpentan-2-yl 1-[2-(2-hydroxy-3-methyl-6-sulfanyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate (PubChem CID 145118419) has the molecular formula C26H37NO6S and a molecular weight of 491.65 g/mol. Its IUPAC name is 3-benzylpentan-2-yl 1-[2-(2-hydroxy-3-methyl-6-sulfanyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate.
| Compound Name | 3-benzylpentan-2-yl 1-[2-(2-hydroxy-3-methyl-6-sulfanyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 145118419 |
| Molecular Formula | C26H37NO6S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 3-benzylpentan-2-yl 1-[2-(2-hydroxy-3-methyl-6-sulfanyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate |
| SMILES | CCC(Cc1ccccc1)C(C)OC(=O)C1CCCCN1C(=O)C(=O)C1(O)OC(S)CCC1C |
| InChI | InChI=1S/C26H37NO6S/c1-4-20(16-19-10-6-5-7-11-19)18(3)32-25(30)21-12-8-9-15-27(21)24(29)23(28)26(31)17(2)13-14-22(34)33-26/h5-7,10-11,17-18,20-22,31,34H,4,8-9,12-16H2,1-3H3 |
| InChIKey | YTVFOZXLZFHWSF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|