C25H39NO8S — CID 145119136
1-(4,5-dihydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)ethyl 1-[2-(2-hydroxy-3-methyl-6-sulfanyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate (PubChem CID 145119136) has the molecular formula C25H39NO8S and a molecular weight of 513.65 g/mol. Its IUPAC name is 1-(4,5-dihydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)ethyl 1-[2-(2-hydroxy-3-methyl-6-sulfanyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate.
| Compound Name | 1-(4,5-dihydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)ethyl 1-[2-(2-hydroxy-3-methyl-6-sulfanyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 145119136 |
| Molecular Formula | C25H39NO8S |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 1-(4,5-dihydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)ethyl 1-[2-(2-hydroxy-3-methyl-6-sulfanyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylate |
| SMILES | CC(OC(=O)C1CCCCN1C(=O)C(=O)C1(O)OC(S)CCC1C)C1CC2CCC(O)C(O)C2C1 |
| InChI | InChI=1S/C25H39NO8S/c1-13-6-9-20(35)34-25(13,32)22(29)23(30)26-10-4-3-5-18(26)24(31)33-14(2)16-11-15-7-8-19(27)21(28)17(15)12-16/h13-21,27-28,32,35H,3-12H2,1-2H3 |
| InChIKey | GJLBUJOENNQECX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|