C14H22FNO4 — CID 155441951
1-(6-fluoro-2-hydroxy-3-methyloxan-2-yl)-2-(2-methylpiperidin-1-yl)ethane-1,2-dione (PubChem CID 155441951) has the molecular formula C14H22FNO4 and a molecular weight of 287.33 g/mol. Its IUPAC name is 1-(6-fluoro-2-hydroxy-3-methyloxan-2-yl)-2-(2-methylpiperidin-1-yl)ethane-1,2-dione.
| Compound Name | 1-(6-fluoro-2-hydroxy-3-methyloxan-2-yl)-2-(2-methylpiperidin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 155441951 |
| Molecular Formula | C14H22FNO4 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-(6-fluoro-2-hydroxy-3-methyloxan-2-yl)-2-(2-methylpiperidin-1-yl)ethane-1,2-dione |
| SMILES | CC1CCCCN1C(=O)C(=O)C1(O)OC(F)CCC1C |
| InChI | InChI=1S/C14H22FNO4/c1-9-6-7-11(15)20-14(9,19)12(17)13(18)16-8-4-3-5-10(16)2/h9-11,19H,3-8H2,1-2H3 |
| InChIKey | CAIVYYVESUIAIO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|