C16H25NO7 — CID 121475544
1-[2-(2-hydroxy-5-methoxy-3,6-dimethyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylic acid (PubChem CID 121475544) has the molecular formula C16H25NO7 and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-[2-(2-hydroxy-5-methoxy-3,6-dimethyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-(2-hydroxy-5-methoxy-3,6-dimethyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 121475544 |
| Molecular Formula | C16H25NO7 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-[2-(2-hydroxy-5-methoxy-3,6-dimethyloxan-2-yl)-2-oxoacetyl]piperidine-2-carboxylic acid |
| SMILES | COC1CC(C)C(O)(C(=O)C(=O)N2CCCCC2C(=O)O)OC1C |
| InChI | InChI=1S/C16H25NO7/c1-9-8-12(23-3)10(2)24-16(9,22)13(18)14(19)17-7-5-4-6-11(17)15(20)21/h9-12,22H,4-8H2,1-3H3,(H,20,21) |
| InChIKey | CLPMVDNBUQONHK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|