C17H27NO6 — CID 154954404
(2S)-1-[2-[(2R,3R)-6-ethyl-2-hydroxy-3,5-dimethyloxan-2-yl]-2-oxoacetyl]piperidine-2-carboxylic acid (PubChem CID 154954404) has the molecular formula C17H27NO6 and a molecular weight of 341.40 g/mol. Its IUPAC name is (2S)-1-[2-[(2R,3R)-6-ethyl-2-hydroxy-3,5-dimethyloxan-2-yl]-2-oxoacetyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-[(2R,3R)-6-ethyl-2-hydroxy-3,5-dimethyloxan-2-yl]-2-oxoacetyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 154954404 |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (2S)-1-[2-[(2R,3R)-6-ethyl-2-hydroxy-3,5-dimethyloxan-2-yl]-2-oxoacetyl]piperidine-2-carboxylic acid |
| SMILES | CCC1O[C@@](O)(C(=O)C(=O)N2CCCC[C@H]2C(=O)O)[C@H](C)CC1C |
| InChI | InChI=1S/C17H27NO6/c1-4-13-10(2)9-11(3)17(23,24-13)14(19)15(20)18-8-6-5-7-12(18)16(21)22/h10-13,23H,4-9H2,1-3H3,(H,21,22)/t10?,11-,12+,13?,17-/m1/s1 |
| InChIKey | ONKHGLKLKIQOES-MJRCBCLYSA-N |
| XLogP | 1.18 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|