C27H25F4N8O3+ — CID 143727683
(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-[[5-[3-(3-hydroxyanilino)-5-(trifluoromethyl)anilino]pyridine-2-carbonyl]amino]azanium (PubChem CID 143727683) has the molecular formula C27H25F4N8O3+ and a molecular weight of 585.54 g/mol. Its IUPAC name is (5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-[[5-[3-(3-hydroxyanilino)-5-(trifluoromethyl)anilino]pyridine-2-carbonyl]amino]azanium.
| Compound Name | (5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-[[5-[3-(3-hydroxyanilino)-5-(trifluoromethyl)anilino]pyridine-2-carbonyl]amino]azanium |
|---|---|
| PubChem CID | 143727683 |
| Molecular Formula | C27H25F4N8O3+ |
| Molecular Weight | 585.54 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | (5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-[[5-[3-(3-hydroxyanilino)-5-(trifluoromethyl)anilino]pyridine-2-carbonyl]amino]azanium |
| SMILES | O=C(N[NH2+]c1ncc(F)c(N2CCOCC2)n1)c1ccc(Nc2cc(Nc3cccc(O)c3)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C27H24F4N8O3/c28-22-15-33-26(36-24(22)39-6-8-42-9-7-39)38-37-25(41)23-5-4-18(14-32-23)35-20-11-16(27(29,30)31)10-19(12-20)34-17-2-1-3-21(40)13-17/h1-5,10-15,34-35,40H,6-9H2,(H,37,41)(H,33,36,38)/p+1 |
| InChIKey | FTYGIPAOPQPESU-UHFFFAOYSA-O |
| XLogP | 3.60 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|