C13H14F3NO — CID 143728803
4-methyl-2-propyl-4-(2,3,4-trifluorophenyl)-5H-1,3-oxazole (PubChem CID 143728803) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-methyl-2-propyl-4-(2,3,4-trifluorophenyl)-5H-1,3-oxazole.
| Compound Name | 4-methyl-2-propyl-4-(2,3,4-trifluorophenyl)-5H-1,3-oxazole |
|---|---|
| PubChem CID | 143728803 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 4-methyl-2-propyl-4-(2,3,4-trifluorophenyl)-5H-1,3-oxazole |
| SMILES | CCCC1=NC(C)(c2ccc(F)c(F)c2F)CO1 |
| InChI | InChI=1S/C13H14F3NO/c1-3-4-10-17-13(2,7-18-10)8-5-6-9(14)12(16)11(8)15/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | LIBZXLIYNUIGNL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|