C22H28ClNO3 — CID 143729238
1-[(4-chlorophenyl)-(4-methylphenyl)methoxy]-3-(oxolan-2-ylmethylamino)propan-2-ol (PubChem CID 143729238) has the molecular formula C22H28ClNO3 and a molecular weight of 389.92 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-(4-methylphenyl)methoxy]-3-(oxolan-2-ylmethylamino)propan-2-ol.
| Compound Name | 1-[(4-chlorophenyl)-(4-methylphenyl)methoxy]-3-(oxolan-2-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 143729238 |
| Molecular Formula | C22H28ClNO3 |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 1-[(4-chlorophenyl)-(4-methylphenyl)methoxy]-3-(oxolan-2-ylmethylamino)propan-2-ol |
| SMILES | Cc1ccc(C(OCC(O)CNCC2CCCO2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H28ClNO3/c1-16-4-6-17(7-5-16)22(18-8-10-19(23)11-9-18)27-15-20(25)13-24-14-21-3-2-12-26-21/h4-11,20-22,24-25H,2-3,12-15H2,1H3 |
| InChIKey | PMGSGDXGCXKSIA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |