C23H33NO — CID 143730109
1-(4-butoxyphenyl)-N-[(3Z,5Z)-5-ethylidenedeca-1,3-dien-2-yl]methanimine (PubChem CID 143730109) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-N-[(3Z,5Z)-5-ethylidenedeca-1,3-dien-2-yl]methanimine.
| Compound Name | 1-(4-butoxyphenyl)-N-[(3Z,5Z)-5-ethylidenedeca-1,3-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 143730109 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 1-(4-butoxyphenyl)-N-[(3Z,5Z)-5-ethylidenedeca-1,3-dien-2-yl]methanimine |
| SMILES | C=C(/C=C\C(=C/C)CCCCC)/N=C/c1ccc(OCCCC)cc1 |
| InChI | InChI=1S/C23H33NO/c1-5-8-10-11-21(7-3)13-12-20(4)24-19-22-14-16-23(17-15-22)25-18-9-6-2/h7,12-17,19H,4-6,8-11,18H2,1-3H3/b13-12-,21-7-,24-19+ |
| InChIKey | AMSHIYCJESCKNJ-NZHBJOJRSA-N |
| XLogP | 6.88 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|