C20H26N2O — CID 138657356
N-[(3Z)-5-[(4-pentylphenyl)methylideneamino]hexa-1,3,5-trien-2-yl]acetamide (PubChem CID 138657356) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is N-[(3Z)-5-[(4-pentylphenyl)methylideneamino]hexa-1,3,5-trien-2-yl]acetamide.
| Compound Name | N-[(3Z)-5-[(4-pentylphenyl)methylideneamino]hexa-1,3,5-trien-2-yl]acetamide |
|---|---|
| PubChem CID | 138657356 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | N-[(3Z)-5-[(4-pentylphenyl)methylideneamino]hexa-1,3,5-trien-2-yl]acetamide |
| SMILES | C=C(/C=C\C(=C)NC(C)=O)/N=C/c1ccc(CCCCC)cc1 |
| InChI | InChI=1S/C20H26N2O/c1-5-6-7-8-19-11-13-20(14-12-19)15-21-16(2)9-10-17(3)22-18(4)23/h9-15H,2-3,5-8H2,1,4H3,(H,22,23)/b10-9-,21-15+ |
| InChIKey | YZMJDKTYWAIWNI-BBBHCPNJSA-N |
| XLogP | 4.56 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|